Torillilovergan Torillilovergan

02-03-2017
Biology

contestada

How did darwin connect animals with the earth?

Respuesta :

hannahbanana00 hannahbanana00

02-03-2017

He documented that they were belongings to certain areas (or locations) of the Earth

Answer Link

Otras preguntas

The HUAC investigation of Hollywood led to the jailing of a group of writers and directors known as the ____________. Fill in the blank. There are no choices

how long will every vain in your body reach

Hyponatremia is a concern of marathon runners which can be caused by

Jack made toast.He knew that a chemical change took place because the bread changed A.color B.shape C.size D.volume

What was Sapa Inca said to be?

The south african orgainsation of inequality in gender?

How do we find the area of each

A car travles 75 miles on 3 gallons of gasoline how much gasoline will it need to go 342 miles

cos(x/3)cos(x/3)=1/2(1+cos(2x/3))

Crossing-over rarely occurs in mitosis, unlike meiosis. Which of the following is the likely reason?