RaysonS399240 RaysonS399240
  • 03-11-2022
  • Mathematics
contestada

Determine the slope of the line through the given points. If the slope is undefined, so state.( 3,2) and (6,11) the slope is?

Respuesta :

JordynJ313951 JordynJ313951
  • 03-11-2022

Given the two points:

[tex]\begin{gathered} (x_1,y_1)=(3,2) \\ \text{and} \\ (x_2,y_2)=(6,11) \end{gathered}[/tex]

The slope (m) is found by using the formula shown below:

[tex]m=\frac{y_2-y_1}{x_2-x_1}[/tex]

To find the slope, we substitute the given points:

[tex]\begin{gathered} m=\frac{y_2-y_1}{x_2-x_1} \\ m=\frac{11-2}{6-3} \\ m=\frac{9}{3} \\ m=3 \end{gathered}[/tex]

The slope is 3.

Answer Link

Otras preguntas

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)
radius/radian/arc length relationships
Solve. [tex]2x+6 \geq -4[/tex]
A company is testing a new device to detect certain substances inside suitcases. Currently, the device is accurate 68% of the time for suitcases that have these
Why should you consider the audience when preparing data for a presentation? Describe the differences in the way you might present numeric data to a group of ch
If f(x) = 5x, what is f–1(x)?
Lola saved $86.25 in three months she saved $30.75 in the first month and $7.99 in the second month how much money did Lola save the third month
what are the symbols of the greek gods
A. 3/22 B. 3/7 C. 8/15 D. 8/11
what is the name of the following compound? a. phenylhyde b. cyclohexylhyde c. benzaldehyde d. phenol aldehyde