gummysarealsome68 gummysarealsome68

03-03-2021
English

contestada

Can someone help me with number 5 plz

Can someone help me with number 5 plz class=

Respuesta :

2026yvettebrom 2026yvettebrom

03-03-2021

Answer:its dramatic

and situational

Explanation:

Answer Link

Otras preguntas

For which scenario would a rousing march be appropriate? Help ASAP, plz right answers A. During a motivational sermon B. Through a sad scene in a movi

What is the purpose of having a safety lanyard onboard a personal watercraft (pwc)?

As the chinese military weakened in the late 1800's, which countries rushed to gain more territory?

Solve for x. [tex] 6-2x-x=18 [/tex]

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

What dimensions would maximize the area of a rectangle with a perimeter of 40 centimeters

Which is a dependent clause? during intermission, while we were discussing the performance dodging frantically, a valet ran through the crowd and into the theat

How did new technologies affect motion pictures in the 1920s?

An Emotional struggle that takes place in the protagonists mind is called

Which of the following is a balanced chemical equation?