zahinparvez69 zahinparvez69
  • 02-06-2020
  • Mathematics
contestada

Question 16 (Essay Worth 7 points)

Verify the identity.

tan (x + π/2) = -cot x

Respuesta :

coolstick
coolstick coolstick
  • 02-06-2020

Step-by-step explanation:

We know that tan=sin/cos, so tan(x+π/2)=

[tex]\frac{sin(x+pi/2)}{cos(x+pi/2)}[/tex]

Then, we know that sin(u+v)=sin(u)cos(v)+cos(u)sin(v),

so our equation is then

[tex]\frac{sin(x)cos(\pi/2)+cos(x)sin(\pi/2)}{cos(x+\pi/2)} = \frac{cos(x)}{cos(x+\pi/2) }[/tex]

Then, cos(u+v)=cos(u)cos(v)-sin(u)sin(v), so our expression is then

[tex]\frac{cos(x)}{cos(x)cos(\pi/2)-sin(x)sin(\pi/2)} = \frac{cos(x)}{-sin(x)} = -cot(x)[/tex]

Answer Link

Otras preguntas

Does every point lie in a quadrant?
How did scientists discover the common structure of cells?
How did scientists discover the common structure of cells?
Dominick lives 1 3/4 miles from his school.  If his mother drives him half the way, how far will Dominick have to walk to get to school?
Write a system of equations with a solution (4,–3)
which state of matter has the least amount of energy?
which seismic wave moves through earth at the fastest speed?
How do you Factor c(squared)-8c ??
Find the value of x.  Round to nearest hundredth if necessary.
Which of the following statements is true concerning LUCA? (1) LUCA was a cell. (2) All life on Earth evolved from LUCA. (3) LUCA probably existed probably arou